C8H13NOS — CID 131144176
(4aS,8aS)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]oxazine-2-thione (PubChem CID 131144176) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is (4aS,8aS)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]oxazine-2-thione.
| Compound Name | (4aS,8aS)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]oxazine-2-thione |
|---|---|
| PubChem CID | 131144176 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | (4aS,8aS)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]oxazine-2-thione |
| SMILES | S=C1N[C@H]2CCCC[C@@H]2CO1 |
| InChI | InChI=1S/C8H13NOS/c11-8-9-7-4-2-1-3-6(7)5-10-8/h6-7H,1-5H2,(H,9,11)/t6-,7+/m1/s1 |
| InChIKey | DABKTXPVFNQALI-RQJHMYQMSA-N |
| XLogP | 1.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|