C10H14N2O2 — CID 131145263
4-[(1R,2S)-1-amino-2-hydroxypropyl]benzamide (PubChem CID 131145263) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxypropyl]benzamide.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxypropyl]benzamide |
|---|---|
| PubChem CID | 131145263 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxypropyl]benzamide |
| SMILES | C[C@H](O)[C@H](N)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C10H14N2O2/c1-6(13)9(11)7-2-4-8(5-3-7)10(12)14/h2-6,9,13H,11H2,1H3,(H2,12,14)/t6-,9-/m0/s1 |
| InChIKey | TUBJCGHUJYJIIP-RCOVLWMOSA-N |
| XLogP | 0.17 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |