C9H16N2S — CID 131146191
cyclohex-2-en-1-yl N,N'-dimethylcarbamimidothioate (PubChem CID 131146191) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is cyclohex-2-en-1-yl N,N'-dimethylcarbamimidothioate.
| Compound Name | cyclohex-2-en-1-yl N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 131146191 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | cyclohex-2-en-1-yl N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(\NC)SC1C=CCCC1 |
| InChI | InChI=1S/C9H16N2S/c1-10-9(11-2)12-8-6-4-3-5-7-8/h4,6,8H,3,5,7H2,1-2H3,(H,10,11) |
| InChIKey | ZNHUTLQIEIDZHM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|