C23H20ClF3N2O3S — CID 1311493
2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-benzyl-N-methylacetamide (PubChem CID 1311493) has the molecular formula C23H20ClF3N2O3S and a molecular weight of 496.94 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-benzyl-N-methylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-benzyl-N-methylacetamide |
|---|---|
| PubChem CID | 1311493 |
| Molecular Formula | C23H20ClF3N2O3S |
| Molecular Weight | 496.94 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-benzyl-N-methylacetamide |
| SMILES | CN(Cc1ccccc1)C(=O)CN(c1cc(C(F)(F)F)ccc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20ClF3N2O3S/c1-28(15-17-8-4-2-5-9-17)22(30)16-29(33(31,32)19-10-6-3-7-11-19)21-14-18(23(25,26)27)12-13-20(21)24/h2-14H,15-16H2,1H3 |
| InChIKey | XGFJKTTXMBLKTL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.94 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |