About methyl furan-2-carboximidate
methyl furan-2-carboximidate (PubChem CID 13114963) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is methyl furan-2-carboximidate.
Molecular Properties
| Compound Name | methyl furan-2-carboximidate |
| PubChem CID | 13114963 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | methyl furan-2-carboximidate |
| SMILES | [H]/N=C(\OC)c1ccco1 |
| InChI | InChI=1S/C6H7NO2/c1-8-6(7)5-3-2-4-9-5/h2-4,7H,1H3/b7-6- |
| InChIKey | LXAAUEZVEFPTPX-SREVYHEPSA-N |
| XLogP | 1.25 |
| TPSA | 46.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl furan-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl furan-2-carboximidate?
The IUPAC name of methyl furan-2-carboximidate (CID 13114963) is methyl furan-2-carboximidate.
What is the SMILES notation for methyl furan-2-carboximidate?
The canonical SMILES for methyl furan-2-carboximidate is [H]/N=C(\OC)c1ccco1.
What is the InChIKey of methyl furan-2-carboximidate?
The InChIKey is LXAAUEZVEFPTPX-SREVYHEPSA-N. The full InChI is InChI=1S/C6H7NO2/c1-8-6(7)5-3-2-4-9-5/h2-4,7H,1H3/b7-6-.
What are the key properties of methyl furan-2-carboximidate?
methyl furan-2-carboximidate has a molecular weight of 125.13 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl furan-2-carboximidate is sourced from PubChem (CID 13114963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).