About 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine
4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine (PubChem CID 131151211) has the molecular formula C10H17F2NS
and a molecular weight of 221.32 g/mol. Its IUPAC name is 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine.
Molecular Properties
| Compound Name | 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine |
| PubChem CID | 131151211 |
| Molecular Formula | C10H17F2NS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine |
| SMILES | NC1CSCC1CC1CCCC1(F)F |
| InChI | InChI=1S/C10H17F2NS/c11-10(12)3-1-2-8(10)4-7-5-14-6-9(7)13/h7-9H,1-6,13H2 |
| InChIKey | BATCZECHTAAPQO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine?
The IUPAC name of 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine (CID 131151211) is 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine.
What is the SMILES notation for 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine?
The canonical SMILES for 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine is NC1CSCC1CC1CCCC1(F)F.
What is the InChIKey of 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine?
The InChIKey is BATCZECHTAAPQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NS/c11-10(12)3-1-2-8(10)4-7-5-14-6-9(7)13/h7-9H,1-6,13H2.
What are the key properties of 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine?
4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine has a molecular weight of 221.32 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-difluorocyclopentyl)methyl]thiolan-3-amine is sourced from PubChem (CID 131151211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).