C18H14N2O — CID 13115140
N,4-diphenylpyridine-3-carboxamide (PubChem CID 13115140) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is N,4-diphenylpyridine-3-carboxamide.
| Compound Name | N,4-diphenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 13115140 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N,4-diphenylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cnccc1-c1ccccc1 |
| InChI | InChI=1S/C18H14N2O/c21-18(20-15-9-5-2-6-10-15)17-13-19-12-11-16(17)14-7-3-1-4-8-14/h1-13H,(H,20,21) |
| InChIKey | WUULJDPDJYCIMB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |