About 6-methoxy-N,N-dimethylhexan-1-amine
6-methoxy-N,N-dimethylhexan-1-amine (PubChem CID 13115265) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is 6-methoxy-N,N-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | 6-methoxy-N,N-dimethylhexan-1-amine |
| PubChem CID | 13115265 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | 6-methoxy-N,N-dimethylhexan-1-amine |
| SMILES | COCCCCCCN(C)C |
| InChI | InChI=1S/C9H21NO/c1-10(2)8-6-4-5-7-9-11-3/h4-9H2,1-3H3 |
| InChIKey | KCQQPYAOFJPIBZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-N,N-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-N,N-dimethylhexan-1-amine?
The IUPAC name of 6-methoxy-N,N-dimethylhexan-1-amine (CID 13115265) is 6-methoxy-N,N-dimethylhexan-1-amine.
What is the SMILES notation for 6-methoxy-N,N-dimethylhexan-1-amine?
The canonical SMILES for 6-methoxy-N,N-dimethylhexan-1-amine is COCCCCCCN(C)C.
What is the InChIKey of 6-methoxy-N,N-dimethylhexan-1-amine?
The InChIKey is KCQQPYAOFJPIBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO/c1-10(2)8-6-4-5-7-9-11-3/h4-9H2,1-3H3.
What are the key properties of 6-methoxy-N,N-dimethylhexan-1-amine?
6-methoxy-N,N-dimethylhexan-1-amine has a molecular weight of 159.27 g/mol, XLogP of 1.75, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-N,N-dimethylhexan-1-amine is sourced from PubChem (CID 13115265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).