C9H16N2OS2 — CID 131153732
1,2,5-dithiazepan-5-yl-[(2R)-pyrrolidin-2-yl]methanone (PubChem CID 131153732) has the molecular formula C9H16N2OS2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1,2,5-dithiazepan-5-yl-[(2R)-pyrrolidin-2-yl]methanone.
| Compound Name | 1,2,5-dithiazepan-5-yl-[(2R)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 131153732 |
| Molecular Formula | C9H16N2OS2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1,2,5-dithiazepan-5-yl-[(2R)-pyrrolidin-2-yl]methanone |
| SMILES | O=C([C@H]1CCCN1)N1CCSSCC1 |
| InChI | InChI=1S/C9H16N2OS2/c12-9(8-2-1-3-10-8)11-4-6-13-14-7-5-11/h8,10H,1-7H2/t8-/m1/s1 |
| InChIKey | HPEPGSZIBCAPGW-MRVPVSSYSA-N |
| XLogP | 0.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|