About 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one
2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one (PubChem CID 131154012) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one.
Molecular Properties
| Compound Name | 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one |
| PubChem CID | 131154012 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one |
| SMILES | CCC(O)C(=O)N1CCSC1 |
| InChI | InChI=1S/C7H13NO2S/c1-2-6(9)7(10)8-3-4-11-5-8/h6,9H,2-5H2,1H3 |
| InChIKey | ZAMKEDTVPOEHJA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one?
The IUPAC name of 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one (CID 131154012) is 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one.
What is the SMILES notation for 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one?
The canonical SMILES for 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one is CCC(O)C(=O)N1CCSC1.
What is the InChIKey of 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one?
The InChIKey is ZAMKEDTVPOEHJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-2-6(9)7(10)8-3-4-11-5-8/h6,9H,2-5H2,1H3.
What are the key properties of 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one?
2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one has a molecular weight of 175.25 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-(1,3-thiazolidin-3-yl)butan-1-one is sourced from PubChem (CID 131154012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).