About (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine
(3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine (PubChem CID 131154288) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine.
Molecular Properties
| Compound Name | (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine |
| PubChem CID | 131154288 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine |
| SMILES | CO[C@H]1CN(C2CCC2)C[C@H]1OC |
| InChI | InChI=1S/C10H19NO2/c1-12-9-6-11(7-10(9)13-2)8-4-3-5-8/h8-10H,3-7H2,1-2H3/t9-,10+ |
| InChIKey | FNXAXFOHUZKICW-AOOOYVTPSA-N |
| XLogP | 0.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine?
The IUPAC name of (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine (CID 131154288) is (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine.
What is the SMILES notation for (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine?
The canonical SMILES for (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine is CO[C@H]1CN(C2CCC2)C[C@H]1OC.
What is the InChIKey of (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine?
The InChIKey is FNXAXFOHUZKICW-AOOOYVTPSA-N. The full InChI is InChI=1S/C10H19NO2/c1-12-9-6-11(7-10(9)13-2)8-4-3-5-8/h8-10H,3-7H2,1-2H3/t9-,10+.
What are the key properties of (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine?
(3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine has a molecular weight of 185.27 g/mol, XLogP of 0.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine is sourced from PubChem (CID 131154288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).