C10H19NO2 — CID 131154288
(3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine (PubChem CID 131154288) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine.
| Compound Name | (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine |
|---|---|
| PubChem CID | 131154288 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (3S,4R)-1-cyclobutyl-3,4-dimethoxypyrrolidine |
| SMILES | CO[C@H]1CN(C2CCC2)C[C@H]1OC |
| InChI | InChI=1S/C10H19NO2/c1-12-9-6-11(7-10(9)13-2)8-4-3-5-8/h8-10H,3-7H2,1-2H3/t9-,10+ |
| InChIKey | FNXAXFOHUZKICW-AOOOYVTPSA-N |
| XLogP | 0.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |