C11H17NO — CID 131154338
(4R,4aS,8aR)-4-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carbonitrile (PubChem CID 131154338) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (4R,4aS,8aR)-4-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carbonitrile.
| Compound Name | (4R,4aS,8aR)-4-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carbonitrile |
|---|---|
| PubChem CID | 131154338 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (4R,4aS,8aR)-4-hydroxy-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carbonitrile |
| SMILES | N#C[C@]12CCCC[C@@H]1CCC[C@H]2O |
| InChI | InChI=1S/C11H17NO/c12-8-11-7-2-1-4-9(11)5-3-6-10(11)13/h9-10,13H,1-7H2/t9-,10-,11-/m1/s1 |
| InChIKey | KCSSNERHPUBUTD-GMTAPVOTSA-N |
| XLogP | 2.23 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |