About 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide
1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide (PubChem CID 131154434) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide |
| PubChem CID | 131154434 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)(C)n1cnc(C(=O)NO)n1 |
| InChI | InChI=1S/C7H12N4O2/c1-7(2,3)11-4-8-5(9-11)6(12)10-13/h4,13H,1-3H3,(H,10,12) |
| InChIKey | DKSNGGLOKUPNDN-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide?
The IUPAC name of 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide (CID 131154434) is 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide is CC(C)(C)n1cnc(C(=O)NO)n1.
What is the InChIKey of 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide?
The InChIKey is DKSNGGLOKUPNDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c1-7(2,3)11-4-8-5(9-11)6(12)10-13/h4,13H,1-3H3,(H,10,12).
What are the key properties of 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide?
1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide has a molecular weight of 184.20 g/mol, XLogP of 0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-N-hydroxy-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 131154434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).