C11H19NOS2 — CID 131154504
2-(1,2,5-dithiazepan-5-ylmethyl)cyclohexan-1-one (PubChem CID 131154504) has the molecular formula C11H19NOS2 and a molecular weight of 245.41 g/mol. Its IUPAC name is 2-(1,2,5-dithiazepan-5-ylmethyl)cyclohexan-1-one.
| Compound Name | 2-(1,2,5-dithiazepan-5-ylmethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 131154504 |
| Molecular Formula | C11H19NOS2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-(1,2,5-dithiazepan-5-ylmethyl)cyclohexan-1-one |
| SMILES | O=C1CCCCC1CN1CCSSCC1 |
| InChI | InChI=1S/C11H19NOS2/c13-11-4-2-1-3-10(11)9-12-5-7-14-15-8-6-12/h10H,1-9H2 |
| InChIKey | GYUOZAOWDNCUIE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|