About N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride
N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride (PubChem CID 13115453) has the molecular formula C10H17Cl3N2S
and a molecular weight of 303.69 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride |
| PubChem CID | 13115453 |
| Molecular Formula | C10H17Cl3N2S |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCCNCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H15ClN2S.2ClH/c11-9-1-3-10(4-2-9)14-8-7-13-6-5-12;;/h1-4,13H,5-8,12H2;2*1H |
| InChIKey | VKEFTTHGILDPDF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride?
The IUPAC name of N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride (CID 13115453) is N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride.
What is the SMILES notation for N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride?
The canonical SMILES for N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride is Cl.Cl.NCCNCCSc1ccc(Cl)cc1.
What is the InChIKey of N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride?
The InChIKey is VKEFTTHGILDPDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2S.2ClH/c11-9-1-3-10(4-2-9)14-8-7-13-6-5-12;;/h1-4,13H,5-8,12H2;2*1H.
What are the key properties of N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride?
N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride has a molecular weight of 303.69 g/mol, XLogP of 2.82, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(4-chlorophenyl)sulfanylethyl]ethane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 13115453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).