About (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol
(2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol (PubChem CID 131154744) has the molecular formula C7H13N3OS
and a molecular weight of 187.27 g/mol. Its IUPAC name is (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol |
| PubChem CID | 131154744 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol |
| SMILES | CC[C@H](CO)Nc1nnc(C)s1 |
| InChI | InChI=1S/C7H13N3OS/c1-3-6(4-11)8-7-10-9-5(2)12-7/h6,11H,3-4H2,1-2H3,(H,8,10)/t6-/m1/s1 |
| InChIKey | CWXDSCZXXNOAQU-ZCFIWIBFSA-N |
| XLogP | 1.03 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol?
The IUPAC name of (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol (CID 131154744) is (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol.
What is the SMILES notation for (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol?
The canonical SMILES for (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol is CC[C@H](CO)Nc1nnc(C)s1.
What is the InChIKey of (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol?
The InChIKey is CWXDSCZXXNOAQU-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H13N3OS/c1-3-6(4-11)8-7-10-9-5(2)12-7/h6,11H,3-4H2,1-2H3,(H,8,10)/t6-/m1/s1.
What are the key properties of (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol?
(2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol has a molecular weight of 187.27 g/mol, XLogP of 1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]butan-1-ol is sourced from PubChem (CID 131154744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).