C10H7N3 — CID 131154765
2-(1,5-naphthyridin-4-yl)acetonitrile (PubChem CID 131154765) has the molecular formula C10H7N3 and a molecular weight of 169.19 g/mol. Its IUPAC name is 2-(1,5-naphthyridin-4-yl)acetonitrile.
| Compound Name | 2-(1,5-naphthyridin-4-yl)acetonitrile |
|---|---|
| PubChem CID | 131154765 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 2-(1,5-naphthyridin-4-yl)acetonitrile |
| SMILES | N#CCc1ccnc2cccnc12 |
| InChI | InChI=1S/C10H7N3/c11-5-3-8-4-7-12-9-2-1-6-13-10(8)9/h1-2,4,6-7H,3H2 |
| InChIKey | FBQUHDNGIUBMKF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |