C10H17FN2O — CID 131154777
(4aR,7aR)-4-[(1-fluorocyclopropyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine (PubChem CID 131154777) has the molecular formula C10H17FN2O and a molecular weight of 200.26 g/mol. Its IUPAC name is (4aR,7aR)-4-[(1-fluorocyclopropyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aR)-4-[(1-fluorocyclopropyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 131154777 |
| Molecular Formula | C10H17FN2O |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (4aR,7aR)-4-[(1-fluorocyclopropyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
| SMILES | FC1(CN2CCO[C@@H]3CNC[C@H]32)CC1 |
| InChI | InChI=1S/C10H17FN2O/c11-10(1-2-10)7-13-3-4-14-9-6-12-5-8(9)13/h8-9,12H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | PYGBTEQHZYPJIP-RKDXNWHRSA-N |
| XLogP | 0.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |