About N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine
N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine (PubChem CID 131155355) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine |
| PubChem CID | 131155355 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine |
| SMILES | CC1OCCC1N(C)CC(F)F |
| InChI | InChI=1S/C8H15F2NO/c1-6-7(3-4-12-6)11(2)5-8(9)10/h6-8H,3-5H2,1-2H3 |
| InChIKey | BAUFQYTYAYEIJX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine?
The IUPAC name of N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine (CID 131155355) is N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine.
What is the SMILES notation for N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine?
The canonical SMILES for N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine is CC1OCCC1N(C)CC(F)F.
What is the InChIKey of N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine?
The InChIKey is BAUFQYTYAYEIJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO/c1-6-7(3-4-12-6)11(2)5-8(9)10/h6-8H,3-5H2,1-2H3.
What are the key properties of N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine?
N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine has a molecular weight of 179.21 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-N,2-dimethyloxolan-3-amine is sourced from PubChem (CID 131155355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).