About N-hydroxy-N',N'-dimethylpropanediamide
N-hydroxy-N',N'-dimethylpropanediamide (PubChem CID 131155759) has the molecular formula C5H10N2O3
and a molecular weight of 146.15 g/mol. Its IUPAC name is N-hydroxy-N',N'-dimethylpropanediamide.
Molecular Properties
| Compound Name | N-hydroxy-N',N'-dimethylpropanediamide |
| PubChem CID | 131155759 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | N-hydroxy-N',N'-dimethylpropanediamide |
| SMILES | CN(C)C(=O)CC(=O)NO |
| InChI | InChI=1S/C5H10N2O3/c1-7(2)5(9)3-4(8)6-10/h10H,3H2,1-2H3,(H,6,8) |
| InChIKey | DNDFOKKPMXNPDX-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N',N'-dimethylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N',N'-dimethylpropanediamide?
The IUPAC name of N-hydroxy-N',N'-dimethylpropanediamide (CID 131155759) is N-hydroxy-N',N'-dimethylpropanediamide.
What is the SMILES notation for N-hydroxy-N',N'-dimethylpropanediamide?
The canonical SMILES for N-hydroxy-N',N'-dimethylpropanediamide is CN(C)C(=O)CC(=O)NO.
What is the InChIKey of N-hydroxy-N',N'-dimethylpropanediamide?
The InChIKey is DNDFOKKPMXNPDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O3/c1-7(2)5(9)3-4(8)6-10/h10H,3H2,1-2H3,(H,6,8).
What are the key properties of N-hydroxy-N',N'-dimethylpropanediamide?
N-hydroxy-N',N'-dimethylpropanediamide has a molecular weight of 146.15 g/mol, XLogP of -1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N',N'-dimethylpropanediamide is sourced from PubChem (CID 131155759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).