About N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine
N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine (PubChem CID 131155864) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine.
Molecular Properties
| Compound Name | N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine |
| PubChem CID | 131155864 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine |
| SMILES | CC1(C)CCC(Nc2cnc[nH]2)C1 |
| InChI | InChI=1S/C10H17N3/c1-10(2)4-3-8(5-10)13-9-6-11-7-12-9/h6-8,13H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | LKOKDOJNQPZWNH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine?
The IUPAC name of N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine (CID 131155864) is N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine.
What is the SMILES notation for N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine?
The canonical SMILES for N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine is CC1(C)CCC(Nc2cnc[nH]2)C1.
What is the InChIKey of N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine?
The InChIKey is LKOKDOJNQPZWNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-10(2)4-3-8(5-10)13-9-6-11-7-12-9/h6-8,13H,3-5H2,1-2H3,(H,11,12).
What are the key properties of N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine?
N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine has a molecular weight of 179.27 g/mol, XLogP of 2.40, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylcyclopentyl)-1H-imidazol-5-amine is sourced from PubChem (CID 131155864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).