About phthalazine-6,7-dicarboxylic acid
phthalazine-6,7-dicarboxylic acid (PubChem CID 13115751) has the molecular formula C10H6N2O4
and a molecular weight of 218.17 g/mol. Its IUPAC name is phthalazine-6,7-dicarboxylic acid.
Molecular Properties
| Compound Name | phthalazine-6,7-dicarboxylic acid |
| PubChem CID | 13115751 |
| Molecular Formula | C10H6N2O4 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | phthalazine-6,7-dicarboxylic acid |
| SMILES | O=C(O)c1cc2cnncc2cc1C(=O)O |
| InChI | InChI=1S/C10H6N2O4/c13-9(14)7-1-5-3-11-12-4-6(5)2-8(7)10(15)16/h1-4H,(H,13,14)(H,15,16) |
| InChIKey | BTXCCTATPJEJQA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phthalazine-6,7-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalazine-6,7-dicarboxylic acid?
The IUPAC name of phthalazine-6,7-dicarboxylic acid (CID 13115751) is phthalazine-6,7-dicarboxylic acid.
What is the SMILES notation for phthalazine-6,7-dicarboxylic acid?
The canonical SMILES for phthalazine-6,7-dicarboxylic acid is O=C(O)c1cc2cnncc2cc1C(=O)O.
What is the InChIKey of phthalazine-6,7-dicarboxylic acid?
The InChIKey is BTXCCTATPJEJQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O4/c13-9(14)7-1-5-3-11-12-4-6(5)2-8(7)10(15)16/h1-4H,(H,13,14)(H,15,16).
What are the key properties of phthalazine-6,7-dicarboxylic acid?
phthalazine-6,7-dicarboxylic acid has a molecular weight of 218.17 g/mol, XLogP of 1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phthalazine-6,7-dicarboxylic acid is sourced from PubChem (CID 13115751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).