C9H10N2O2 — CID 131159596
3-ethyl-5-(5-methylfuran-2-yl)-1,2,4-oxadiazole (PubChem CID 131159596) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-ethyl-5-(5-methylfuran-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-ethyl-5-(5-methylfuran-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 131159596 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 3-ethyl-5-(5-methylfuran-2-yl)-1,2,4-oxadiazole |
| SMILES | CCc1noc(-c2ccc(C)o2)n1 |
| InChI | InChI=1S/C9H10N2O2/c1-3-8-10-9(13-11-8)7-5-4-6(2)12-7/h4-5H,3H2,1-2H3 |
| InChIKey | YQZIPZYVPZXQBY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |