C9H16FNO2 — CID 131159955
(2S)-N-[(1-fluorocyclopentyl)methyl]-2-hydroxypropanamide (PubChem CID 131159955) has the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. Its IUPAC name is (2S)-N-[(1-fluorocyclopentyl)methyl]-2-hydroxypropanamide.
| Compound Name | (2S)-N-[(1-fluorocyclopentyl)methyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 131159955 |
| Molecular Formula | C9H16FNO2 |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (2S)-N-[(1-fluorocyclopentyl)methyl]-2-hydroxypropanamide |
| SMILES | C[C@H](O)C(=O)NCC1(F)CCCC1 |
| InChI | InChI=1S/C9H16FNO2/c1-7(12)8(13)11-6-9(10)4-2-3-5-9/h7,12H,2-6H2,1H3,(H,11,13)/t7-/m0/s1 |
| InChIKey | FXTWEDUTPVYGQK-ZETCQYMHSA-N |
| XLogP | 0.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |