About 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol
2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol (PubChem CID 131159973) has the molecular formula C8H12FN3O
and a molecular weight of 185.20 g/mol. Its IUPAC name is 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol |
| PubChem CID | 131159973 |
| Molecular Formula | C8H12FN3O |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol |
| SMILES | Cc1nc(C)c(F)c(NCCO)n1 |
| InChI | InChI=1S/C8H12FN3O/c1-5-7(9)8(10-3-4-13)12-6(2)11-5/h13H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | PRTXPAWKVQLBQI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol?
The IUPAC name of 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol (CID 131159973) is 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol.
What is the SMILES notation for 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol?
The canonical SMILES for 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol is Cc1nc(C)c(F)c(NCCO)n1.
What is the InChIKey of 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol?
The InChIKey is PRTXPAWKVQLBQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12FN3O/c1-5-7(9)8(10-3-4-13)12-6(2)11-5/h13H,3-4H2,1-2H3,(H,10,11,12).
What are the key properties of 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol?
2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol has a molecular weight of 185.20 g/mol, XLogP of 0.64, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]ethanol is sourced from PubChem (CID 131159973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).