C9H20ClN3 — CID 131160056
1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propan-2-amine;hydrochloride (PubChem CID 131160056) has the molecular formula C9H20ClN3 and a molecular weight of 205.73 g/mol. Its IUPAC name is 1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propan-2-amine;hydrochloride.
| Compound Name | 1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 131160056 |
| Molecular Formula | C9H20ClN3 |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 1-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propan-2-amine;hydrochloride |
| SMILES | CC(N)CN1CC[C@H]2CNC[C@H]21.Cl |
| InChI | InChI=1S/C9H19N3.ClH/c1-7(10)6-12-3-2-8-4-11-5-9(8)12;/h7-9,11H,2-6,10H2,1H3;1H/t7?,8-,9+;/m0./s1 |
| InChIKey | KHGUZAHZLZTQCA-ZKKFVHNYSA-N |
| XLogP | 0.05 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |