About 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile
2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile (PubChem CID 131160163) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile |
| PubChem CID | 131160163 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile |
| SMILES | N#CCN1C[C@@H]2C(CO)[C@@H]2C1 |
| InChI | InChI=1S/C8H12N2O/c9-1-2-10-3-6-7(4-10)8(6)5-11/h6-8,11H,2-5H2/t6-,7+,8? |
| InChIKey | LKYYRKIOLKEHMX-DHBOJHSNSA-N |
| XLogP | -0.32 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile?
The IUPAC name of 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile (CID 131160163) is 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile.
What is the SMILES notation for 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile?
The canonical SMILES for 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile is N#CCN1C[C@@H]2C(CO)[C@@H]2C1.
What is the InChIKey of 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile?
The InChIKey is LKYYRKIOLKEHMX-DHBOJHSNSA-N. The full InChI is InChI=1S/C8H12N2O/c9-1-2-10-3-6-7(4-10)8(6)5-11/h6-8,11H,2-5H2/t6-,7+,8?.
What are the key properties of 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile?
2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile has a molecular weight of 152.20 g/mol, XLogP of -0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexan-3-yl]acetonitrile is sourced from PubChem (CID 131160163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).