About 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol
3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol (PubChem CID 131160291) has the molecular formula C9H14FN3O
and a molecular weight of 199.23 g/mol. Its IUPAC name is 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol |
| PubChem CID | 131160291 |
| Molecular Formula | C9H14FN3O |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol |
| SMILES | Cc1nc(C)c(F)c(NCCCO)n1 |
| InChI | InChI=1S/C9H14FN3O/c1-6-8(10)9(11-4-3-5-14)13-7(2)12-6/h14H,3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | CEQWSCWLRXVEAU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol?
The IUPAC name of 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol (CID 131160291) is 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol?
The canonical SMILES for 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol is Cc1nc(C)c(F)c(NCCCO)n1.
What is the InChIKey of 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol?
The InChIKey is CEQWSCWLRXVEAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN3O/c1-6-8(10)9(11-4-3-5-14)13-7(2)12-6/h14H,3-5H2,1-2H3,(H,11,12,13).
What are the key properties of 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol?
3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol has a molecular weight of 199.23 g/mol, XLogP of 1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-fluoro-2,6-dimethylpyrimidin-4-yl)amino]propan-1-ol is sourced from PubChem (CID 131160291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).