C9H3F15 — CID 13116050
4-(difluoromethylidene)-1,1,1,2,2,5,5,6,6,6-decafluoro-3-methyl-3-(trifluoromethyl)hexane (PubChem CID 13116050) has the molecular formula C9H3F15 and a molecular weight of 396.09 g/mol. Its IUPAC name is 4-(difluoromethylidene)-1,1,1,2,2,5,5,6,6,6-decafluoro-3-methyl-3-(trifluoromethyl)hexane.
| Compound Name | 4-(difluoromethylidene)-1,1,1,2,2,5,5,6,6,6-decafluoro-3-methyl-3-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 13116050 |
| Molecular Formula | C9H3F15 |
| Molecular Weight | 396.09 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | 4-(difluoromethylidene)-1,1,1,2,2,5,5,6,6,6-decafluoro-3-methyl-3-(trifluoromethyl)hexane |
| SMILES | CC(C(=C(F)F)C(F)(F)C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H3F15/c1-4(7(16,17)18,6(14,15)9(22,23)24)2(3(10)11)5(12,13)8(19,20)21/h1H3 |
| InChIKey | MWAVPJUNGVVSJR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.09 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|