About N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine
N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine (PubChem CID 131160565) has the molecular formula C9H12FN3
and a molecular weight of 181.21 g/mol. Its IUPAC name is N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine.
Molecular Properties
| Compound Name | N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine |
| PubChem CID | 131160565 |
| Molecular Formula | C9H12FN3 |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine |
| SMILES | F[C@H]1CCC[C@H]1Nc1cccnn1 |
| InChI | InChI=1S/C9H12FN3/c10-7-3-1-4-8(7)12-9-5-2-6-11-13-9/h2,5-8H,1,3-4H2,(H,12,13)/t7-,8+/m0/s1 |
| InChIKey | TWAJZBMBLSQUFL-JGVFFNPUSA-N |
| XLogP | 1.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine?
The IUPAC name of N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine (CID 131160565) is N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine.
What is the SMILES notation for N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine?
The canonical SMILES for N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine is F[C@H]1CCC[C@H]1Nc1cccnn1.
What is the InChIKey of N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine?
The InChIKey is TWAJZBMBLSQUFL-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H12FN3/c10-7-3-1-4-8(7)12-9-5-2-6-11-13-9/h2,5-8H,1,3-4H2,(H,12,13)/t7-,8+/m0/s1.
What are the key properties of N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine?
N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine has a molecular weight of 181.21 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-2-fluorocyclopentyl]pyridazin-3-amine is sourced from PubChem (CID 131160565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).