C11H20N2O — CID 131160645
(3aS,6aS)-1-(oxolan-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole (PubChem CID 131160645) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is (3aS,6aS)-1-(oxolan-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole.
| Compound Name | (3aS,6aS)-1-(oxolan-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 131160645 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (3aS,6aS)-1-(oxolan-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
| SMILES | C1CC(CN2CC[C@H]3CNC[C@H]32)CO1 |
| InChI | InChI=1S/C11H20N2O/c1-3-13(7-9-2-4-14-8-9)11-6-12-5-10(1)11/h9-12H,1-8H2/t9?,10-,11+/m0/s1 |
| InChIKey | BREDGGINNCSBIU-QXXIUIOUSA-N |
| XLogP | 0.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |