C11H18O — CID 131160822
trans-(1R,5R)-2,2-dimethyl-5-prop-1-en-2-ylcyclopentane-1-carbaldehyde (PubChem CID 131160822) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is trans-(1R,5R)-2,2-dimethyl-5-prop-1-en-2-ylcyclopentane-1-carbaldehyde.
| Compound Name | trans-(1R,5R)-2,2-dimethyl-5-prop-1-en-2-ylcyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 131160822 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | trans-(1R,5R)-2,2-dimethyl-5-prop-1-en-2-ylcyclopentane-1-carbaldehyde |
| SMILES | C=C(C)[C@@H]1CCC(C)(C)[C@@H]1C=O |
| InChI | InChI=1S/C11H18O/c1-8(2)9-5-6-11(3,4)10(9)7-12/h7,9-10H,1,5-6H2,2-4H3/t9-,10+/m0/s1 |
| InChIKey | AEPUVDUCMZWGKY-VHSXEESVSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|