C17H14N7O+ — CID 13116213
(3,5-diamino-2-phenyl-[1,2,4]triazolo[3,4-c][1,2,4]triazin-4-ium-6-yl)-phenylmethanone (PubChem CID 13116213) has the molecular formula C17H14N7O+ and a molecular weight of 332.35 g/mol. Its IUPAC name is (3,5-diamino-2-phenyl-[1,2,4]triazolo[3,4-c][1,2,4]triazin-4-ium-6-yl)-phenylmethanone.
| Compound Name | (3,5-diamino-2-phenyl-[1,2,4]triazolo[3,4-c][1,2,4]triazin-4-ium-6-yl)-phenylmethanone |
|---|---|
| PubChem CID | 13116213 |
| Molecular Formula | C17H14N7O+ |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (3,5-diamino-2-phenyl-[1,2,4]triazolo[3,4-c][1,2,4]triazin-4-ium-6-yl)-phenylmethanone |
| SMILES | Nc1c(C(=O)c2ccccc2)nnc2nn(-c3ccccc3)c(N)[n+]12 |
| InChI | InChI=1S/C17H13N7O/c18-15-13(14(25)11-7-3-1-4-8-11)20-21-17-22-24(16(19)23(15)17)12-9-5-2-6-10-12/h1-10,19H,(H2,18,21,22,25)/p+1 |
| InChIKey | LMZHYNKHKMXNEN-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|