About 3-methylthieno[3,2-b]pyridin-5-amine
3-methylthieno[3,2-b]pyridin-5-amine (PubChem CID 131162328) has the molecular formula C8H8N2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 3-methylthieno[3,2-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 3-methylthieno[3,2-b]pyridin-5-amine |
| PubChem CID | 131162328 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 3-methylthieno[3,2-b]pyridin-5-amine |
| SMILES | Cc1csc2ccc(N)nc12 |
| InChI | InChI=1S/C8H8N2S/c1-5-4-11-6-2-3-7(9)10-8(5)6/h2-4H,1H3,(H2,9,10) |
| InChIKey | IUPGBZIBSQCSNI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylthieno[3,2-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylthieno[3,2-b]pyridin-5-amine?
The IUPAC name of 3-methylthieno[3,2-b]pyridin-5-amine (CID 131162328) is 3-methylthieno[3,2-b]pyridin-5-amine.
What is the SMILES notation for 3-methylthieno[3,2-b]pyridin-5-amine?
The canonical SMILES for 3-methylthieno[3,2-b]pyridin-5-amine is Cc1csc2ccc(N)nc12.
What is the InChIKey of 3-methylthieno[3,2-b]pyridin-5-amine?
The InChIKey is IUPGBZIBSQCSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S/c1-5-4-11-6-2-3-7(9)10-8(5)6/h2-4H,1H3,(H2,9,10).
What are the key properties of 3-methylthieno[3,2-b]pyridin-5-amine?
3-methylthieno[3,2-b]pyridin-5-amine has a molecular weight of 164.23 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylthieno[3,2-b]pyridin-5-amine is sourced from PubChem (CID 131162328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).