C10H20ClN3O — CID 131163040
[(3R)-3-aminopiperidin-1-yl]-pyrrolidin-3-ylmethanone;hydrochloride (PubChem CID 131163040) has the molecular formula C10H20ClN3O and a molecular weight of 233.74 g/mol. Its IUPAC name is [(3R)-3-aminopiperidin-1-yl]-pyrrolidin-3-ylmethanone;hydrochloride.
| Compound Name | [(3R)-3-aminopiperidin-1-yl]-pyrrolidin-3-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 131163040 |
| Molecular Formula | C10H20ClN3O |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | [(3R)-3-aminopiperidin-1-yl]-pyrrolidin-3-ylmethanone;hydrochloride |
| SMILES | Cl.N[C@@H]1CCCN(C(=O)C2CCNC2)C1 |
| InChI | InChI=1S/C10H19N3O.ClH/c11-9-2-1-5-13(7-9)10(14)8-3-4-12-6-8;/h8-9,12H,1-7,11H2;1H/t8?,9-;/m1./s1 |
| InChIKey | MDDGQAFFATXNLF-ICLMXVQUSA-N |
| XLogP | -0.03 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |