About 3,4-dinitrosohexane
3,4-dinitrosohexane (PubChem CID 13116314) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 3,4-dinitrosohexane.
Molecular Properties
| Compound Name | 3,4-dinitrosohexane |
| PubChem CID | 13116314 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 3,4-dinitrosohexane |
| SMILES | CCC(N=O)C(CC)N=O |
| InChI | InChI=1S/C6H12N2O2/c1-3-5(7-9)6(4-2)8-10/h5-6H,3-4H2,1-2H3 |
| InChIKey | RIQDXTJEHSZFEY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-dinitrosohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dinitrosohexane?
The IUPAC name of 3,4-dinitrosohexane (CID 13116314) is 3,4-dinitrosohexane.
What is the SMILES notation for 3,4-dinitrosohexane?
The canonical SMILES for 3,4-dinitrosohexane is CCC(N=O)C(CC)N=O.
What is the InChIKey of 3,4-dinitrosohexane?
The InChIKey is RIQDXTJEHSZFEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-3-5(7-9)6(4-2)8-10/h5-6H,3-4H2,1-2H3.
What are the key properties of 3,4-dinitrosohexane?
3,4-dinitrosohexane has a molecular weight of 144.17 g/mol, XLogP of 2.08, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dinitrosohexane is sourced from PubChem (CID 13116314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).