About 1,2-dinitrosocyclohexane
1,2-dinitrosocyclohexane (PubChem CID 13116335) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 1,2-dinitrosocyclohexane.
Molecular Properties
| Compound Name | 1,2-dinitrosocyclohexane |
| PubChem CID | 13116335 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 1,2-dinitrosocyclohexane |
| SMILES | O=NC1CCCCC1N=O |
| InChI | InChI=1S/C6H10N2O2/c9-7-5-3-1-2-4-6(5)8-10/h5-6H,1-4H2 |
| InChIKey | XCJOMFFNVGLZCV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-dinitrosocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dinitrosocyclohexane?
The IUPAC name of 1,2-dinitrosocyclohexane (CID 13116335) is 1,2-dinitrosocyclohexane.
What is the SMILES notation for 1,2-dinitrosocyclohexane?
The canonical SMILES for 1,2-dinitrosocyclohexane is O=NC1CCCCC1N=O.
What is the InChIKey of 1,2-dinitrosocyclohexane?
The InChIKey is XCJOMFFNVGLZCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c9-7-5-3-1-2-4-6(5)8-10/h5-6H,1-4H2.
What are the key properties of 1,2-dinitrosocyclohexane?
1,2-dinitrosocyclohexane has a molecular weight of 142.16 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dinitrosocyclohexane is sourced from PubChem (CID 13116335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).