C9H10FNO3S — CID 131165546
2-(ethylsulfinylamino)-4-fluorobenzoic acid (PubChem CID 131165546) has the molecular formula C9H10FNO3S and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-(ethylsulfinylamino)-4-fluorobenzoic acid.
| Compound Name | 2-(ethylsulfinylamino)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 131165546 |
| Molecular Formula | C9H10FNO3S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-(ethylsulfinylamino)-4-fluorobenzoic acid |
| SMILES | CCS(=O)Nc1cc(F)ccc1C(=O)O |
| InChI | InChI=1S/C9H10FNO3S/c1-2-15(14)11-8-5-6(10)3-4-7(8)9(12)13/h3-5,11H,2H2,1H3,(H,12,13) |
| InChIKey | PKFVXTIJVMYGLQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |