C8H7BrClN3OS — CID 131165776
N-[(2-bromothiophen-3-yl)methyl]-5-(chloromethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 131165776) has the molecular formula C8H7BrClN3OS and a molecular weight of 308.59 g/mol. Its IUPAC name is N-[(2-bromothiophen-3-yl)methyl]-5-(chloromethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-[(2-bromothiophen-3-yl)methyl]-5-(chloromethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 131165776 |
| Molecular Formula | C8H7BrClN3OS |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.92 |
| IUPAC Name | N-[(2-bromothiophen-3-yl)methyl]-5-(chloromethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | ClCc1nnc(NCc2ccsc2Br)o1 |
| InChI | InChI=1S/C8H7BrClN3OS/c9-7-5(1-2-15-7)4-11-8-13-12-6(3-10)14-8/h1-2H,3-4H2,(H,11,13) |
| InChIKey | WCZFOCAVQNLGAK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|