About 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one
2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one (PubChem CID 13116581) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one.
Molecular Properties
| Compound Name | 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one |
| PubChem CID | 13116581 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one |
| SMILES | CCC(=O)C(C)C1=C(C)C(=O)C(C)C(CC)O1 |
| InChI | InChI=1S/C14H22O3/c1-6-11(15)8(3)14-10(5)13(16)9(4)12(7-2)17-14/h8-9,12H,6-7H2,1-5H3 |
| InChIKey | GOXHJNFKZUOQCT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one?
The IUPAC name of 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one (CID 13116581) is 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one.
What is the SMILES notation for 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one?
The canonical SMILES for 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one is CCC(=O)C(C)C1=C(C)C(=O)C(C)C(CC)O1.
What is the InChIKey of 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one?
The InChIKey is GOXHJNFKZUOQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-6-11(15)8(3)14-10(5)13(16)9(4)12(7-2)17-14/h8-9,12H,6-7H2,1-5H3.
What are the key properties of 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one?
2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one has a molecular weight of 238.33 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,5-dimethyl-6-(3-oxopentan-2-yl)-2,3-dihydropyran-4-one is sourced from PubChem (CID 13116581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).