C6H11BrO2 — CID 131166569
(4S,5S)-2-(bromomethyl)-4,5-dimethyl-1,3-dioxolane (PubChem CID 131166569) has the molecular formula C6H11BrO2 and a molecular weight of 195.06 g/mol. Its IUPAC name is (4S,5S)-2-(bromomethyl)-4,5-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-2-(bromomethyl)-4,5-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 131166569 |
| Molecular Formula | C6H11BrO2 |
| Molecular Weight | 195.06 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | (4S,5S)-2-(bromomethyl)-4,5-dimethyl-1,3-dioxolane |
| SMILES | C[C@@H]1OC(CBr)O[C@H]1C |
| InChI | InChI=1S/C6H11BrO2/c1-4-5(2)9-6(3-7)8-4/h4-6H,3H2,1-2H3/t4-,5-/m0/s1 |
| InChIKey | MLTXBVPEJSXWGA-WHFBIAKZSA-N |
| XLogP | 1.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.06 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|