About 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione
1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione (PubChem CID 13116707) has the molecular formula C10H6N4O6
and a molecular weight of 278.18 g/mol. Its IUPAC name is 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione |
| PubChem CID | 13116707 |
| Molecular Formula | C10H6N4O6 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione |
| SMILES | O=C(C(=O)n1ccc(=O)[nH]c1=O)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H6N4O6/c15-5-1-3-13(9(19)11-5)7(17)8(18)14-4-2-6(16)12-10(14)20/h1-4H,(H,11,15,19)(H,12,16,20) |
| InChIKey | AEWRYSHHMSTEAZ-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione?
The IUPAC name of 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione (CID 13116707) is 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione.
What is the SMILES notation for 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione?
The canonical SMILES for 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione is O=C(C(=O)n1ccc(=O)[nH]c1=O)n1ccc(=O)[nH]c1=O.
What is the InChIKey of 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione?
The InChIKey is AEWRYSHHMSTEAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N4O6/c15-5-1-3-13(9(19)11-5)7(17)8(18)14-4-2-6(16)12-10(14)20/h1-4H,(H,11,15,19)(H,12,16,20).
What are the key properties of 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione?
1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione has a molecular weight of 278.18 g/mol, XLogP of -2.63, 0 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dioxopyrimidin-1-yl)-2-oxoacetyl]pyrimidine-2,4-dione is sourced from PubChem (CID 13116707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).