About trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane
trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane (PubChem CID 131167739) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane.
Molecular Properties
| Compound Name | trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane |
| PubChem CID | 131167739 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane |
| SMILES | CC1(C)[C@H](N=C=O)[C@H]1N=C=O |
| InChI | InChI=1S/C7H8N2O2/c1-7(2)5(8-3-10)6(7)9-4-11/h5-6H,1-2H3/t5-,6-/m1/s1 |
| InChIKey | VJQIFWYDEXDCQS-PHDIDXHHSA-N |
| XLogP | 0.44 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane?
The IUPAC name of trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane (CID 131167739) is trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane.
What is the SMILES notation for trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane?
The canonical SMILES for trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane is CC1(C)[C@H](N=C=O)[C@H]1N=C=O.
What is the InChIKey of trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane?
The InChIKey is VJQIFWYDEXDCQS-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-7(2)5(8-3-10)6(7)9-4-11/h5-6H,1-2H3/t5-,6-/m1/s1.
What are the key properties of trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane?
trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane has a molecular weight of 152.15 g/mol, XLogP of 0.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,3S)-2,3-diisocyanato-1,1-dimethylcyclopropane is sourced from PubChem (CID 131167739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).