C10H15NO3 — CID 131169151
(3S,4R)-3-(2,2-dimethylpropanoyl)-4-methylpyrrolidine-2,5-dione (PubChem CID 131169151) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (3S,4R)-3-(2,2-dimethylpropanoyl)-4-methylpyrrolidine-2,5-dione.
| Compound Name | (3S,4R)-3-(2,2-dimethylpropanoyl)-4-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 131169151 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (3S,4R)-3-(2,2-dimethylpropanoyl)-4-methylpyrrolidine-2,5-dione |
| SMILES | C[C@H]1C(=O)NC(=O)[C@@H]1C(=O)C(C)(C)C |
| InChI | InChI=1S/C10H15NO3/c1-5-6(7(12)10(2,3)4)9(14)11-8(5)13/h5-6H,1-4H3,(H,11,13,14)/t5-,6+/m1/s1 |
| InChIKey | SQIMMCFUKXTHRO-RITPCOANSA-N |
| XLogP | 0.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|