C9H5BrI2S — CID 131169476
4-(bromomethyl)-6,7-diiodo-1-benzothiophene (PubChem CID 131169476) has the molecular formula C9H5BrI2S and a molecular weight of 478.92 g/mol. Its IUPAC name is 4-(bromomethyl)-6,7-diiodo-1-benzothiophene.
| Compound Name | 4-(bromomethyl)-6,7-diiodo-1-benzothiophene |
|---|---|
| PubChem CID | 131169476 |
| Molecular Formula | C9H5BrI2S |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 477.74 |
| IUPAC Name | 4-(bromomethyl)-6,7-diiodo-1-benzothiophene |
| SMILES | BrCc1cc(I)c(I)c2sccc12 |
| InChI | InChI=1S/C9H5BrI2S/c10-4-5-3-7(11)8(12)9-6(5)1-2-13-9/h1-3H,4H2 |
| InChIKey | WKPKUMAXTMEOAH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|