C8H8N2S2 — CID 131169667
6,7-diamino-1-benzothiophene-5-thiol (PubChem CID 131169667) has the molecular formula C8H8N2S2 and a molecular weight of 196.30 g/mol. Its IUPAC name is 6,7-diamino-1-benzothiophene-5-thiol.
| Compound Name | 6,7-diamino-1-benzothiophene-5-thiol |
|---|---|
| PubChem CID | 131169667 |
| Molecular Formula | C8H8N2S2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 6,7-diamino-1-benzothiophene-5-thiol |
| SMILES | Nc1c(S)cc2ccsc2c1N |
| InChI | InChI=1S/C8H8N2S2/c9-6-5(11)3-4-1-2-12-8(4)7(6)10/h1-3,11H,9-10H2 |
| InChIKey | YLSDLBBUCHYWCQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|