About 3-ethoxy-2,4-dimethyl-1-benzothiophene
3-ethoxy-2,4-dimethyl-1-benzothiophene (PubChem CID 131169695) has the molecular formula C12H14OS
and a molecular weight of 206.31 g/mol. Its IUPAC name is 3-ethoxy-2,4-dimethyl-1-benzothiophene.
Molecular Properties
| Compound Name | 3-ethoxy-2,4-dimethyl-1-benzothiophene |
| PubChem CID | 131169695 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3-ethoxy-2,4-dimethyl-1-benzothiophene |
| SMILES | CCOc1c(C)sc2cccc(C)c12 |
| InChI | InChI=1S/C12H14OS/c1-4-13-12-9(3)14-10-7-5-6-8(2)11(10)12/h5-7H,4H2,1-3H3 |
| InChIKey | NOEIZQYPESYQMA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-2,4-dimethyl-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2,4-dimethyl-1-benzothiophene?
The IUPAC name of 3-ethoxy-2,4-dimethyl-1-benzothiophene (CID 131169695) is 3-ethoxy-2,4-dimethyl-1-benzothiophene.
What is the SMILES notation for 3-ethoxy-2,4-dimethyl-1-benzothiophene?
The canonical SMILES for 3-ethoxy-2,4-dimethyl-1-benzothiophene is CCOc1c(C)sc2cccc(C)c12.
What is the InChIKey of 3-ethoxy-2,4-dimethyl-1-benzothiophene?
The InChIKey is NOEIZQYPESYQMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14OS/c1-4-13-12-9(3)14-10-7-5-6-8(2)11(10)12/h5-7H,4H2,1-3H3.
What are the key properties of 3-ethoxy-2,4-dimethyl-1-benzothiophene?
3-ethoxy-2,4-dimethyl-1-benzothiophene has a molecular weight of 206.31 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2,4-dimethyl-1-benzothiophene is sourced from PubChem (CID 131169695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).