About 9-amino-1,4-benzoxazepine-3,5-dione
9-amino-1,4-benzoxazepine-3,5-dione (PubChem CID 131172420) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is 9-amino-1,4-benzoxazepine-3,5-dione.
Molecular Properties
| Compound Name | 9-amino-1,4-benzoxazepine-3,5-dione |
| PubChem CID | 131172420 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 9-amino-1,4-benzoxazepine-3,5-dione |
| SMILES | Nc1cccc2c1OCC(=O)NC2=O |
| InChI | InChI=1S/C9H8N2O3/c10-6-3-1-2-5-8(6)14-4-7(12)11-9(5)13/h1-3H,4,10H2,(H,11,12,13) |
| InChIKey | FUHFWENJLZJDIK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-1,4-benzoxazepine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-1,4-benzoxazepine-3,5-dione?
The IUPAC name of 9-amino-1,4-benzoxazepine-3,5-dione (CID 131172420) is 9-amino-1,4-benzoxazepine-3,5-dione.
What is the SMILES notation for 9-amino-1,4-benzoxazepine-3,5-dione?
The canonical SMILES for 9-amino-1,4-benzoxazepine-3,5-dione is Nc1cccc2c1OCC(=O)NC2=O.
What is the InChIKey of 9-amino-1,4-benzoxazepine-3,5-dione?
The InChIKey is FUHFWENJLZJDIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c10-6-3-1-2-5-8(6)14-4-7(12)11-9(5)13/h1-3H,4,10H2,(H,11,12,13).
What are the key properties of 9-amino-1,4-benzoxazepine-3,5-dione?
9-amino-1,4-benzoxazepine-3,5-dione has a molecular weight of 192.17 g/mol, XLogP of -0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-1,4-benzoxazepine-3,5-dione is sourced from PubChem (CID 131172420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).