About spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol
spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol (PubChem CID 131173016) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol.
Molecular Properties
| Compound Name | spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol |
| PubChem CID | 131173016 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol |
| SMILES | OCC1CCC2(CCC3CCC2O3)O1 |
| InChI | InChI=1S/C11H18O3/c12-7-9-4-6-11(14-9)5-3-8-1-2-10(11)13-8/h8-10,12H,1-7H2 |
| InChIKey | IOXANOCJIBSZNY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol?
The IUPAC name of spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol (CID 131173016) is spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol.
What is the SMILES notation for spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol?
The canonical SMILES for spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol is OCC1CCC2(CCC3CCC2O3)O1.
What is the InChIKey of spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol?
The InChIKey is IOXANOCJIBSZNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c12-7-9-4-6-11(14-9)5-3-8-1-2-10(11)13-8/h8-10,12H,1-7H2.
What are the key properties of spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol?
spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol has a molecular weight of 198.26 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[8-oxabicyclo[3.2.1]octane-2,5'-oxolane]-2'-ylmethanol is sourced from PubChem (CID 131173016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).