About (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine
(4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 131173128) has the molecular formula C10H12INO
and a molecular weight of 289.12 g/mol. Its IUPAC name is (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine.
Molecular Properties
| Compound Name | (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine |
| PubChem CID | 131173128 |
| Molecular Formula | C10H12INO |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | Cc1cc(I)c2c(c1)[C@H](N)CCO2 |
| InChI | InChI=1S/C10H12INO/c1-6-4-7-9(12)2-3-13-10(7)8(11)5-6/h4-5,9H,2-3,12H2,1H3/t9-/m1/s1 |
| InChIKey | UFUWSJMPJPINMO-SECBINFHSA-N |
| XLogP | 2.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine?
The IUPAC name of (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine (CID 131173128) is (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine.
What is the SMILES notation for (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine?
The canonical SMILES for (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine is Cc1cc(I)c2c(c1)[C@H](N)CCO2.
What is the InChIKey of (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine?
The InChIKey is UFUWSJMPJPINMO-SECBINFHSA-N. The full InChI is InChI=1S/C10H12INO/c1-6-4-7-9(12)2-3-13-10(7)8(11)5-6/h4-5,9H,2-3,12H2,1H3/t9-/m1/s1.
What are the key properties of (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine?
(4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine has a molecular weight of 289.12 g/mol, XLogP of 2.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-8-iodo-6-methyl-3,4-dihydro-2H-chromen-4-amine is sourced from PubChem (CID 131173128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).